About 3-methyl-5,7a-dihydroindazol-1-amine
3-methyl-5,7a-dihydroindazol-1-amine (PubChem CID 90977846) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3-methyl-5,7a-dihydroindazol-1-amine.
Molecular Properties
| Compound Name | 3-methyl-5,7a-dihydroindazol-1-amine |
| PubChem CID | 90977846 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3-methyl-5,7a-dihydroindazol-1-amine |
| SMILES | CC1=NN(N)C2C=CCC=C12 |
| InChI | InChI=1S/C8H11N3/c1-6-7-4-2-3-5-8(7)11(9)10-6/h3-5,8H,2,9H2,1H3 |
| InChIKey | REWGYIRSBHUIKL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5,7a-dihydroindazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,7a-dihydroindazol-1-amine?
The IUPAC name of 3-methyl-5,7a-dihydroindazol-1-amine (CID 90977846) is 3-methyl-5,7a-dihydroindazol-1-amine.
What is the SMILES notation for 3-methyl-5,7a-dihydroindazol-1-amine?
The canonical SMILES for 3-methyl-5,7a-dihydroindazol-1-amine is CC1=NN(N)C2C=CCC=C12.
What is the InChIKey of 3-methyl-5,7a-dihydroindazol-1-amine?
The InChIKey is REWGYIRSBHUIKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6-7-4-2-3-5-8(7)11(9)10-6/h3-5,8H,2,9H2,1H3.
What are the key properties of 3-methyl-5,7a-dihydroindazol-1-amine?
3-methyl-5,7a-dihydroindazol-1-amine has a molecular weight of 149.20 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,7a-dihydroindazol-1-amine is sourced from PubChem (CID 90977846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).