C9H12N2 — CID 21336393
1,3-dimethyl-5,7a-dihydroindazole (PubChem CID 21336393) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1,3-dimethyl-5,7a-dihydroindazole.
| Compound Name | 1,3-dimethyl-5,7a-dihydroindazole |
|---|---|
| PubChem CID | 21336393 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1,3-dimethyl-5,7a-dihydroindazole |
| SMILES | CC1=NN(C)C2C=CCC=C12 |
| InChI | InChI=1S/C9H12N2/c1-7-8-5-3-4-6-9(8)11(2)10-7/h4-6,9H,3H2,1-2H3 |
| InChIKey | IZIUPYLHQXFPNA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|