C11H16N2 — CID 123792832
N-(but-3-en-2-ylideneamino)-N-methylcyclohexa-2,4-dien-1-amine (PubChem CID 123792832) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-(but-3-en-2-ylideneamino)-N-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | N-(but-3-en-2-ylideneamino)-N-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123792832 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-(but-3-en-2-ylideneamino)-N-methylcyclohexa-2,4-dien-1-amine |
| SMILES | C=CC(C)=NN(C)C1C=CC=CC1 |
| InChI | InChI=1S/C11H16N2/c1-4-10(2)12-13(3)11-8-6-5-7-9-11/h4-8,11H,1,9H2,2-3H3 |
| InChIKey | JMZBAXTUANXVNK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|