C10H18N2 — CID 134257690
2,7-diethyl-3-methyl-3,4-dihydrodiazepine (PubChem CID 134257690) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is 2,7-diethyl-3-methyl-3,4-dihydrodiazepine.
| Compound Name | 2,7-diethyl-3-methyl-3,4-dihydrodiazepine |
|---|---|
| PubChem CID | 134257690 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2,7-diethyl-3-methyl-3,4-dihydrodiazepine |
| SMILES | CCC1=NN(CC)C(C)CC=C1 |
| InChI | InChI=1S/C10H18N2/c1-4-10-8-6-7-9(3)12(5-2)11-10/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | KPZBCCVYXTYDPL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |