C15H20ClN5 — CID 123733073
(7R)-N-(2-chloro-5-isocyanopyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine (PubChem CID 123733073) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is (7R)-N-(2-chloro-5-isocyanopyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine.
| Compound Name | (7R)-N-(2-chloro-5-isocyanopyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
|---|---|
| PubChem CID | 123733073 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (7R)-N-(2-chloro-5-isocyanopyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
| SMILES | [C-]#[N+]c1cnc(Cl)nc1N[C@@H]1CC2CCCN2C(C)(C)C1 |
| InChI | InChI=1S/C15H20ClN5/c1-15(2)8-10(7-11-5-4-6-21(11)15)19-13-12(17-3)9-18-14(16)20-13/h9-11H,4-8H2,1-2H3,(H,18,19,20)/t10-,11?/m1/s1 |
| InChIKey | HKOHBVXLOOBXNN-NFJWQWPMSA-N |
| XLogP | 3.50 |
| TPSA | 45.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|