C11H21N3 — CID 123735888
1-butan-2-yl-N,3,4,5-tetramethylimidazol-2-imine (PubChem CID 123735888) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-butan-2-yl-N,3,4,5-tetramethylimidazol-2-imine.
| Compound Name | 1-butan-2-yl-N,3,4,5-tetramethylimidazol-2-imine |
|---|---|
| PubChem CID | 123735888 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-butan-2-yl-N,3,4,5-tetramethylimidazol-2-imine |
| SMILES | CCC(C)n1c(C)c(C)n(C)/c1=N\C |
| InChI | InChI=1S/C11H21N3/c1-7-8(2)14-10(4)9(3)13(6)11(14)12-5/h8H,7H2,1-6H3/b12-11+ |
| InChIKey | JQDATYFTOCKKBB-VAWYXSNFSA-N |
| XLogP | 1.94 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |