C7H12N2 — CID 5232550
1,3,4,5-tetramethyl-2H-imidazol-1-ium-2-ide (PubChem CID 5232550) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3,4,5-tetramethyl-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 5232550 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1,3,4,5-tetramethyl-2H-imidazol-1-ium-2-ide |
| SMILES | Cc1c(C)[n+](C)[c-]n1C |
| InChI | InChI=1S/C7H12N2/c1-6-7(2)9(4)5-8(6)3/h1-4H3 |
| InChIKey | QYECFYPTXHJTKF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|