C11H20N2Ru+ — CID 177478515
4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-1-ium-2-ide;ruthenium(1+) (PubChem CID 177478515) has the molecular formula C11H20N2Ru+ and a molecular weight of 281.37 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-1-ium-2-ide;ruthenium(1+).
| Compound Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-1-ium-2-ide;ruthenium(1+) |
|---|---|
| PubChem CID | 177478515 |
| Molecular Formula | C11H20N2Ru+ |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-1-ium-2-ide;ruthenium(1+) |
| SMILES | Cc1c(C)[n+](C(C)C)[c-]n1C(C)C.[Ru+] |
| InChI | InChI=1S/C11H20N2.Ru/c1-8(2)12-7-13(9(3)4)11(6)10(12)5;/h8-9H,1-6H3;/q;+1 |
| InChIKey | GJPJUTHUDRNWBC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|