C22H17N7 — CID 123736286
N-[1-(5-methyl-1-phenylbenzimidazol-2-yl)prop-2-ynyl]-7H-purin-6-amine (PubChem CID 123736286) has the molecular formula C22H17N7 and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[1-(5-methyl-1-phenylbenzimidazol-2-yl)prop-2-ynyl]-7H-purin-6-amine.
| Compound Name | N-[1-(5-methyl-1-phenylbenzimidazol-2-yl)prop-2-ynyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123736286 |
| Molecular Formula | C22H17N7 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[1-(5-methyl-1-phenylbenzimidazol-2-yl)prop-2-ynyl]-7H-purin-6-amine |
| SMILES | C#CC(Nc1ncnc2nc[nH]c12)c1nc2cc(C)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C22H17N7/c1-3-16(27-21-19-20(24-12-23-19)25-13-26-21)22-28-17-11-14(2)9-10-18(17)29(22)15-7-5-4-6-8-15/h1,4-13,16H,2H3,(H2,23,24,25,26,27) |
| InChIKey | JOJGASMCUVAYBC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|