C19H22F2N4O3 — CID 123738473
N-[[3-(difluoromethoxy)-2-[(2,4-dimethylphenoxy)methyl]-N-methylanilino]diazenyl]-N-methylformamide (PubChem CID 123738473) has the molecular formula C19H22F2N4O3 and a molecular weight of 392.41 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-2-[(2,4-dimethylphenoxy)methyl]-N-methylanilino]diazenyl]-N-methylformamide.
| Compound Name | N-[[3-(difluoromethoxy)-2-[(2,4-dimethylphenoxy)methyl]-N-methylanilino]diazenyl]-N-methylformamide |
|---|---|
| PubChem CID | 123738473 |
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[[3-(difluoromethoxy)-2-[(2,4-dimethylphenoxy)methyl]-N-methylanilino]diazenyl]-N-methylformamide |
| SMILES | Cc1ccc(OCc2c(OC(F)F)cccc2N(C)N=NN(C)C=O)c(C)c1 |
| InChI | InChI=1S/C19H22F2N4O3/c1-13-8-9-17(14(2)10-13)27-11-15-16(25(4)23-22-24(3)12-26)6-5-7-18(15)28-19(20)21/h5-10,12,19H,11H2,1-4H3 |
| InChIKey | WQIWWEITFUFCBP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|