C14H19F2N7O3 — CID 144784198
1-[3-(difluoromethoxy)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-methylhydrazine;formohydrazide (PubChem CID 144784198) has the molecular formula C14H19F2N7O3 and a molecular weight of 371.35 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-methylhydrazine;formohydrazide.
| Compound Name | 1-[3-(difluoromethoxy)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-methylhydrazine;formohydrazide |
|---|---|
| PubChem CID | 144784198 |
| Molecular Formula | C14H19F2N7O3 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[3-(difluoromethoxy)-2-[(5-methyl-1,2,4-triazin-6-yl)oxymethyl]phenyl]-1-methylhydrazine;formohydrazide |
| SMILES | Cc1ncnnc1OCc1c(OC(F)F)cccc1N(C)N.NNC=O |
| InChI | InChI=1S/C13H15F2N5O2.CH4N2O/c1-8-12(19-18-7-17-8)21-6-9-10(20(2)16)4-3-5-11(9)22-13(14)15;2-3-1-4/h3-5,7,13H,6,16H2,1-2H3;1H,2H2,(H,3,4) |
| InChIKey | ZAHOHBCUFJELFM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 141.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|