C41H28N2O6 — CID 123739274
12-ethynyl-7,18-bis[(4-methoxyphenyl)methyl]-9-methyl-7,18-diazahexacyclo[14.6.2.02,11.05,10.013,23.020,24]tetracosa-1(23),2,4,9,11,13,15,20(24),21-nonaene-6,8,17,19-tetrone (PubChem CID 123739274) has the molecular formula C41H28N2O6 and a molecular weight of 644.68 g/mol. Its IUPAC name is 12-ethynyl-7,18-bis[(4-methoxyphenyl)methyl]-9-methyl-7,18-diazahexacyclo[14.6.2.02,11.05,10.013,23.020,24]tetracosa-1(23),2,4,9,11,13,15,20(24),21-nonaene-6,8,17,19-tetrone.
| Compound Name | 12-ethynyl-7,18-bis[(4-methoxyphenyl)methyl]-9-methyl-7,18-diazahexacyclo[14.6.2.02,11.05,10.013,23.020,24]tetracosa-1(23),2,4,9,11,13,15,20(24),21-nonaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 123739274 |
| Molecular Formula | C41H28N2O6 |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | 12-ethynyl-7,18-bis[(4-methoxyphenyl)methyl]-9-methyl-7,18-diazahexacyclo[14.6.2.02,11.05,10.013,23.020,24]tetracosa-1(23),2,4,9,11,13,15,20(24),21-nonaene-6,8,17,19-tetrone |
| SMILES | C#Cc1c2ccc3c4c(ccc(c5ccc6c(c15)=C(C)C(=O)N(Cc1ccc(OC)cc1)C6=O)c24)C(=O)N(Cc1ccc(OC)cc1)C3=O |
| InChI | InChI=1S/C41H28N2O6/c1-5-27-28-14-18-32-37-33(41(47)43(40(32)46)21-24-8-12-26(49-4)13-9-24)19-16-30(36(28)37)29-15-17-31-34(35(27)29)22(2)38(44)42(39(31)45)20-23-6-10-25(48-3)11-7-23/h1,6-19H,20-21H2,2-4H3 |
| InChIKey | OGFGHWOFBAVJCQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|