C26H38N4O5 — CID 123741652
cyclopentyl 4-[[5-[3-[1-(2-methylprop-1-enoxy)ethoxyamino]-3-oxoprop-1-enyl]-2-pyridinyl]methylamino]piperidine-4-carboxylate (PubChem CID 123741652) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is cyclopentyl 4-[[5-[3-[1-(2-methylprop-1-enoxy)ethoxyamino]-3-oxoprop-1-enyl]-2-pyridinyl]methylamino]piperidine-4-carboxylate.
| Compound Name | cyclopentyl 4-[[5-[3-[1-(2-methylprop-1-enoxy)ethoxyamino]-3-oxoprop-1-enyl]-2-pyridinyl]methylamino]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 123741652 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | cyclopentyl 4-[[5-[3-[1-(2-methylprop-1-enoxy)ethoxyamino]-3-oxoprop-1-enyl]-2-pyridinyl]methylamino]piperidine-4-carboxylate |
| SMILES | CC(C)=COC(C)ONC(=O)C=Cc1ccc(CNC2(C(=O)OC3CCCC3)CCNCC2)nc1 |
| InChI | InChI=1S/C26H38N4O5/c1-19(2)18-33-20(3)35-30-24(31)11-9-21-8-10-22(28-16-21)17-29-26(12-14-27-15-13-26)25(32)34-23-6-4-5-7-23/h8-11,16,18,20,23,27,29H,4-7,12-15,17H2,1-3H3,(H,30,31) |
| InChIKey | IYDALYZCYRTKCV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|