C16H29N — CID 123745403
N-(2,5-dimethyl-3-propylidenehept-5-enyl)-2-methylpropan-1-imine (PubChem CID 123745403) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-(2,5-dimethyl-3-propylidenehept-5-enyl)-2-methylpropan-1-imine.
| Compound Name | N-(2,5-dimethyl-3-propylidenehept-5-enyl)-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 123745403 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-(2,5-dimethyl-3-propylidenehept-5-enyl)-2-methylpropan-1-imine |
| SMILES | CC=C(C)CC(=CCC)C(C)C/N=C/C(C)C |
| InChI | InChI=1S/C16H29N/c1-7-9-16(10-14(5)8-2)15(6)12-17-11-13(3)4/h8-9,11,13,15H,7,10,12H2,1-6H3/b14-8?,16-9?,17-11+ |
| InChIKey | WZANOZMKGIDLEN-AXALQEGBSA-N |
| XLogP | 5.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|