C12H22 — CID 123748018
1,4-dimethyl-2-pent-1-enylcyclopentane (PubChem CID 123748018) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 1,4-dimethyl-2-pent-1-enylcyclopentane.
| Compound Name | 1,4-dimethyl-2-pent-1-enylcyclopentane |
|---|---|
| PubChem CID | 123748018 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 1,4-dimethyl-2-pent-1-enylcyclopentane |
| SMILES | CCCC=CC1CC(C)CC1C |
| InChI | InChI=1S/C12H22/c1-4-5-6-7-12-9-10(2)8-11(12)3/h6-7,10-12H,4-5,8-9H2,1-3H3 |
| InChIKey | YQGNXFYSLBLJLL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|