C14H18N4O2S — CID 123749536
ethyl 2-imino-2-(9-imino-2-methylsulfanyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-8-yl)acetate (PubChem CID 123749536) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 2-imino-2-(9-imino-2-methylsulfanyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-8-yl)acetate.
| Compound Name | ethyl 2-imino-2-(9-imino-2-methylsulfanyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-8-yl)acetate |
|---|---|
| PubChem CID | 123749536 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl 2-imino-2-(9-imino-2-methylsulfanyl-5,6,7,8-tetrahydrocyclohepta[d]pyrimidin-8-yl)acetate |
| SMILES | [H]/N=C(\C(=O)OCC)C1CCCc2cnc(SC)nc2/C1=N\[H] |
| InChI | InChI=1S/C14H18N4O2S/c1-3-20-13(19)11(16)9-6-4-5-8-7-17-14(21-2)18-12(8)10(9)15/h7,9,15-16H,3-6H2,1-2H3/b15-10-,16-11- |
| InChIKey | WSQKUGYEJLOYPN-XCMCHEKJSA-N |
| XLogP | 2.10 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|