C20H36N2O9Si — CID 123750354
dimethyl 2,7-diacetamido-4-triethoxysilyloct-4-enedioate (PubChem CID 123750354) has the molecular formula C20H36N2O9Si and a molecular weight of 476.60 g/mol. Its IUPAC name is dimethyl 2,7-diacetamido-4-triethoxysilyloct-4-enedioate.
| Compound Name | dimethyl 2,7-diacetamido-4-triethoxysilyloct-4-enedioate |
|---|---|
| PubChem CID | 123750354 |
| Molecular Formula | C20H36N2O9Si |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | dimethyl 2,7-diacetamido-4-triethoxysilyloct-4-enedioate |
| SMILES | CCO[Si](OCC)(OCC)C(=CCC(NC(C)=O)C(=O)OC)CC(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C20H36N2O9Si/c1-8-29-32(30-9-2,31-10-3)16(13-18(20(26)28-7)22-15(5)24)11-12-17(19(25)27-6)21-14(4)23/h11,17-18H,8-10,12-13H2,1-7H3,(H,21,23)(H,22,24) |
| InChIKey | OFFLUAIOMJGJDJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|