C21H34N2O2 — CID 123758972
[(2S)-4-(2-aminophenyl)-3-cyclohexylbutan-2-yl] N-tert-butylcarbamate (PubChem CID 123758972) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is [(2S)-4-(2-aminophenyl)-3-cyclohexylbutan-2-yl] N-tert-butylcarbamate.
| Compound Name | [(2S)-4-(2-aminophenyl)-3-cyclohexylbutan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 123758972 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | [(2S)-4-(2-aminophenyl)-3-cyclohexylbutan-2-yl] N-tert-butylcarbamate |
| SMILES | C[C@H](OC(=O)NC(C)(C)C)C(Cc1ccccc1N)C1CCCCC1 |
| InChI | InChI=1S/C21H34N2O2/c1-15(25-20(24)23-21(2,3)4)18(16-10-6-5-7-11-16)14-17-12-8-9-13-19(17)22/h8-9,12-13,15-16,18H,5-7,10-11,14,22H2,1-4H3,(H,23,24)/t15-,18?/m0/s1 |
| InChIKey | HBHGETPSTUZCAZ-BUSXIPJBSA-N |
| XLogP | 4.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|