C11H17N3 — CID 123759356
(Z)-5-(3,4-dihydropyridin-6-yl)-5-imino-2-methylpent-3-en-1-amine (PubChem CID 123759356) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is (Z)-5-(3,4-dihydropyridin-6-yl)-5-imino-2-methylpent-3-en-1-amine.
| Compound Name | (Z)-5-(3,4-dihydropyridin-6-yl)-5-imino-2-methylpent-3-en-1-amine |
|---|---|
| PubChem CID | 123759356 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | (Z)-5-(3,4-dihydropyridin-6-yl)-5-imino-2-methylpent-3-en-1-amine |
| SMILES | [H]/N=C(/C=C\C(C)CN)C1=CCCC=N1 |
| InChI | InChI=1S/C11H17N3/c1-9(8-12)5-6-10(13)11-4-2-3-7-14-11/h4-7,9,13H,2-3,8,12H2,1H3/b6-5-,13-10- |
| InChIKey | IFYUPSODUKNCPR-MUIHLJEFSA-N |
| XLogP | 1.91 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|