C8H14N2 — CID 91119270
1-(3-methyl-3,4-dihydropyridin-6-yl)ethanamine (PubChem CID 91119270) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-(3-methyl-3,4-dihydropyridin-6-yl)ethanamine.
| Compound Name | 1-(3-methyl-3,4-dihydropyridin-6-yl)ethanamine |
|---|---|
| PubChem CID | 91119270 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-(3-methyl-3,4-dihydropyridin-6-yl)ethanamine |
| SMILES | CC1C=NC(C(C)N)=CC1 |
| InChI | InChI=1S/C8H14N2/c1-6-3-4-8(7(2)9)10-5-6/h4-7H,3,9H2,1-2H3 |
| InChIKey | MMXMNNOGFRKDKV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |