C10H12F3N3O2 — CID 123766639
tert-butyl N-[2-(trifluoromethyl)pyrimidin-5-yl]carbamate (PubChem CID 123766639) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is tert-butyl N-[2-(trifluoromethyl)pyrimidin-5-yl]carbamate.
| Compound Name | tert-butyl N-[2-(trifluoromethyl)pyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 123766639 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | tert-butyl N-[2-(trifluoromethyl)pyrimidin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H12F3N3O2/c1-9(2,3)18-8(17)16-6-4-14-7(15-5-6)10(11,12)13/h4-5H,1-3H3,(H,16,17) |
| InChIKey | OSZHIBZGVSLWDI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |