C33H38F3N3O8S2 — CID 123767102
methyl (2R)-5-[[amino-[(2,2,5,8-tetramethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylmethyl]pentanoate (PubChem CID 123767102) has the molecular formula C33H38F3N3O8S2 and a molecular weight of 725.81 g/mol. Its IUPAC name is methyl (2R)-5-[[amino-[(2,2,5,8-tetramethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylmethyl]pentanoate.
| Compound Name | methyl (2R)-5-[[amino-[(2,2,5,8-tetramethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylmethyl]pentanoate |
|---|---|
| PubChem CID | 123767102 |
| Molecular Formula | C33H38F3N3O8S2 |
| Molecular Weight | 725.81 g/mol |
| Exact Mass | 725.21 |
| IUPAC Name | methyl (2R)-5-[[amino-[(2,2,5,8-tetramethyl-3,4-dihydrochromen-6-yl)sulfonylamino]methylidene]amino]-2-[[3,5-difluoro-4-(4-fluorophenoxy)phenyl]sulfonylmethyl]pentanoate |
| SMILES | COC(=O)C(CCC/N=C(\N)NS(=O)(=O)c1cc(C)c2c(c1C)CCC(C)(C)O2)CS(=O)(=O)c1cc(F)c(Oc2ccc(F)cc2)c(F)c1 |
| InChI | InChI=1S/C33H38F3N3O8S2/c1-19-15-28(20(2)25-12-13-33(3,4)47-29(19)25)49(43,44)39-32(37)38-14-6-7-21(31(40)45-5)18-48(41,42)24-16-26(35)30(27(36)17-24)46-23-10-8-22(34)9-11-23/h8-11,15-17,21H,6-7,12-14,18H2,1-5H3,(H3,37,38,39) |
| InChIKey | IUXBWXGRJGFQLD-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.81 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|