C25H23F3N6 — CID 123767861
N,N,4-trimethyl-2-[2-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]ethylideneamino]quinazolin-7-amine (PubChem CID 123767861) has the molecular formula C25H23F3N6 and a molecular weight of 464.50 g/mol. Its IUPAC name is N,N,4-trimethyl-2-[2-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]ethylideneamino]quinazolin-7-amine.
| Compound Name | N,N,4-trimethyl-2-[2-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]ethylideneamino]quinazolin-7-amine |
|---|---|
| PubChem CID | 123767861 |
| Molecular Formula | C25H23F3N6 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N,N,4-trimethyl-2-[2-[5-[3-(trifluoromethyl)anilino]-2-pyridinyl]ethylideneamino]quinazolin-7-amine |
| SMILES | Cc1nc(N=CCc2ccc(Nc3cccc(C(F)(F)F)c3)cn2)nc2cc(N(C)C)ccc12 |
| InChI | InChI=1S/C25H23F3N6/c1-16-22-10-9-21(34(2)3)14-23(22)33-24(31-16)29-12-11-18-7-8-20(15-30-18)32-19-6-4-5-17(13-19)25(26,27)28/h4-10,12-15,32H,11H2,1-3H3 |
| InChIKey | OGSGOJDZNDUYBL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|