C22H26Cl3N3O3 — CID 123773025
benzyl N-(4-oxo-4-piperidin-4-ylbutyl)carbamate;3,4,5-trichloropyridine (PubChem CID 123773025) has the molecular formula C22H26Cl3N3O3 and a molecular weight of 486.83 g/mol. Its IUPAC name is benzyl N-(4-oxo-4-piperidin-4-ylbutyl)carbamate;3,4,5-trichloropyridine.
| Compound Name | benzyl N-(4-oxo-4-piperidin-4-ylbutyl)carbamate;3,4,5-trichloropyridine |
|---|---|
| PubChem CID | 123773025 |
| Molecular Formula | C22H26Cl3N3O3 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | benzyl N-(4-oxo-4-piperidin-4-ylbutyl)carbamate;3,4,5-trichloropyridine |
| SMILES | Clc1cncc(Cl)c1Cl.O=C(NCCCC(=O)C1CCNCC1)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O3.C5H2Cl3N/c20-16(15-8-11-18-12-9-15)7-4-10-19-17(21)22-13-14-5-2-1-3-6-14;6-3-1-9-2-4(7)5(3)8/h1-3,5-6,15,18H,4,7-13H2,(H,19,21);1-2H |
| InChIKey | YTHHIPCWVUOGLG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|