C19H26N2O4 — CID 139846289
benzyl N-[5-[(2S)-4-methyl-3-oxopiperidin-2-yl]-5-oxopentyl]carbamate (PubChem CID 139846289) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is benzyl N-[5-[(2S)-4-methyl-3-oxopiperidin-2-yl]-5-oxopentyl]carbamate.
| Compound Name | benzyl N-[5-[(2S)-4-methyl-3-oxopiperidin-2-yl]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 139846289 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | benzyl N-[5-[(2S)-4-methyl-3-oxopiperidin-2-yl]-5-oxopentyl]carbamate |
| SMILES | CC1CCN[C@@H](C(=O)CCCCNC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H26N2O4/c1-14-10-12-20-17(18(14)23)16(22)9-5-6-11-21-19(24)25-13-15-7-3-2-4-8-15/h2-4,7-8,14,17,20H,5-6,9-13H2,1H3,(H,21,24)/t14?,17-/m0/s1 |
| InChIKey | SFCVNGVJMBRWBP-JRZJBTRGSA-N |
| XLogP | 2.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|