C26H28N2 — CID 123773941
7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-2,9-dimethyl-2,3,5,6-tetrahydro-1,10-phenanthroline (PubChem CID 123773941) has the molecular formula C26H28N2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-2,9-dimethyl-2,3,5,6-tetrahydro-1,10-phenanthroline.
| Compound Name | 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-2,9-dimethyl-2,3,5,6-tetrahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 123773941 |
| Molecular Formula | C26H28N2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 7-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-2,9-dimethyl-2,3,5,6-tetrahydro-1,10-phenanthroline |
| SMILES | Cc1cc(C2=CCCC=C2)c2c(n1)C1=NC(C)CC(C3C=CC=CC3)=C1CC2 |
| InChI | InChI=1S/C26H28N2/c1-17-15-23(19-9-5-3-6-10-19)21-13-14-22-24(20-11-7-4-8-12-20)16-18(2)28-26(22)25(21)27-17/h3,5-7,9,11-12,16-17,19H,4,8,10,13-15H2,1-2H3 |
| InChIKey | SHXNAGYDZJRZDF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |