C7H20N2Si — CID 123774390
1-N,1-N'-diethyl-2-methylsilylethane-1,1-diamine (PubChem CID 123774390) has the molecular formula C7H20N2Si and a molecular weight of 160.34 g/mol. Its IUPAC name is 1-N,1-N'-diethyl-2-methylsilylethane-1,1-diamine.
| Compound Name | 1-N,1-N'-diethyl-2-methylsilylethane-1,1-diamine |
|---|---|
| PubChem CID | 123774390 |
| Molecular Formula | C7H20N2Si |
| Molecular Weight | 160.34 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | 1-N,1-N'-diethyl-2-methylsilylethane-1,1-diamine |
| SMILES | CCNC(C[SiH2]C)NCC |
| InChI | InChI=1S/C7H20N2Si/c1-4-8-7(6-10-3)9-5-2/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | JVJONMLOJHGEGX-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|