C8H20N2O2 — CID 141323212
2-[2,2-bis(ethylamino)ethoxy]ethanol (PubChem CID 141323212) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-[2,2-bis(ethylamino)ethoxy]ethanol.
| Compound Name | 2-[2,2-bis(ethylamino)ethoxy]ethanol |
|---|---|
| PubChem CID | 141323212 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 2-[2,2-bis(ethylamino)ethoxy]ethanol |
| SMILES | CCNC(COCCO)NCC |
| InChI | InChI=1S/C8H20N2O2/c1-3-9-8(10-4-2)7-12-6-5-11/h8-11H,3-7H2,1-2H3 |
| InChIKey | KHVAJFMXCUMUHX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|