C30H30BNO2 — CID 123777717
1-cyclohexa-1,3-dien-1-yl-3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (PubChem CID 123777717) has the molecular formula C30H30BNO2 and a molecular weight of 447.39 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
|---|---|
| PubChem CID | 123777717 |
| Molecular Formula | C30H30BNO2 |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-3-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
| SMILES | CC1(C)OB(c2ccc3[nH]c4c(C5=CC=CCC5)cc(-c5ccccc5)cc4c3c2)OC1(C)C |
| InChI | InChI=1S/C30H30BNO2/c1-29(2)30(3,4)34-31(33-29)23-15-16-27-25(19-23)26-18-22(20-11-7-5-8-12-20)17-24(28(26)32-27)21-13-9-6-10-14-21/h5-9,11-13,15-19,32H,10,14H2,1-4H3 |
| InChIKey | KUKUPDPHKGEKPT-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|