C26H24BNO3 — CID 144904781
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-3-azahexacyclo[11.9.0.02,10.04,9.014,19.020,22]docosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene (PubChem CID 144904781) has the molecular formula C26H24BNO3 and a molecular weight of 409.29 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-3-azahexacyclo[11.9.0.02,10.04,9.014,19.020,22]docosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-3-azahexacyclo[11.9.0.02,10.04,9.014,19.020,22]docosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 144904781 |
| Molecular Formula | C26H24BNO3 |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21-oxa-3-azahexacyclo[11.9.0.02,10.04,9.014,19.020,22]docosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
| SMILES | CC1(C)OB(c2ccc3[nH]c4c5c(ccc4c3c2)-c2ccccc2C2OC52)OC1(C)C |
| InChI | InChI=1S/C26H24BNO3/c1-25(2)26(3,4)31-27(30-25)14-9-12-20-19(13-14)17-11-10-16-15-7-5-6-8-18(15)23-24(29-23)21(16)22(17)28-20/h5-13,23-24,28H,1-4H3 |
| InChIKey | LYNJIYRZXIDECR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|