C26H25BN2O2 — CID 142731237
11-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-indolizino[2,3-b]indole (PubChem CID 142731237) has the molecular formula C26H25BN2O2 and a molecular weight of 408.31 g/mol. Its IUPAC name is 11-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-indolizino[2,3-b]indole.
| Compound Name | 11-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-indolizino[2,3-b]indole |
|---|---|
| PubChem CID | 142731237 |
| Molecular Formula | C26H25BN2O2 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 11-phenyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-10H-indolizino[2,3-b]indole |
| SMILES | CC1(C)OB(c2ccc3[nH]c4c(-c5ccccc5)c5ccccn5c4c3c2)OC1(C)C |
| InChI | InChI=1S/C26H25BN2O2/c1-25(2)26(3,4)31-27(30-25)18-13-14-20-19(16-18)24-23(28-20)22(17-10-6-5-7-11-17)21-12-8-9-15-29(21)24/h5-16,28H,1-4H3 |
| InChIKey | AMTCXGPQCYOWTQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|