C10H16N2 — CID 123778151
1,8-dimethyl-2,3,7,8a-tetrahydro-1,8-naphthyridine (PubChem CID 123778151) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1,8-dimethyl-2,3,7,8a-tetrahydro-1,8-naphthyridine.
| Compound Name | 1,8-dimethyl-2,3,7,8a-tetrahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 123778151 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1,8-dimethyl-2,3,7,8a-tetrahydro-1,8-naphthyridine |
| SMILES | CN1CC=CC2=CCCN(C)C21 |
| InChI | InChI=1S/C10H16N2/c1-11-7-3-5-9-6-4-8-12(2)10(9)11/h3,5-6,10H,4,7-8H2,1-2H3 |
| InChIKey | UXEDZIOCBGXICI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |