C23H32N2 — CID 145346180
N'-[(4-ethenylcyclohepta-2,4,6-trien-1-yl)methyl]-N'-[(2E,4Z,6Z)-5-ethenylocta-2,4,6-trienyl]-N,N-dimethylmethanediamine (PubChem CID 145346180) has the molecular formula C23H32N2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N'-[(4-ethenylcyclohepta-2,4,6-trien-1-yl)methyl]-N'-[(2E,4Z,6Z)-5-ethenylocta-2,4,6-trienyl]-N,N-dimethylmethanediamine.
| Compound Name | N'-[(4-ethenylcyclohepta-2,4,6-trien-1-yl)methyl]-N'-[(2E,4Z,6Z)-5-ethenylocta-2,4,6-trienyl]-N,N-dimethylmethanediamine |
|---|---|
| PubChem CID | 145346180 |
| Molecular Formula | C23H32N2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | N'-[(4-ethenylcyclohepta-2,4,6-trien-1-yl)methyl]-N'-[(2E,4Z,6Z)-5-ethenylocta-2,4,6-trienyl]-N,N-dimethylmethanediamine |
| SMILES | C=CC1=CC=CC(CN(C/C=C/C=C(C=C)\C=C/C)CN(C)C)C=C1 |
| InChI | InChI=1S/C23H32N2/c1-6-12-21(7-2)13-9-10-18-25(20-24(4)5)19-23-15-11-14-22(8-3)16-17-23/h6-17,23H,2-3,18-20H2,1,4-5H3/b10-9+,12-6-,21-13- |
| InChIKey | RGNHUENHCFYUIF-JLLDCZEWSA-N |
| XLogP | 4.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|