C19H30N2 — CID 145107088
N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine (PubChem CID 145107088) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine.
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine |
|---|---|
| PubChem CID | 145107088 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine |
| SMILES | C=C/C=C(\C=C)CN(CC)CN(CC)CC1=CCCC=C1 |
| InChI | InChI=1S/C19H30N2/c1-5-12-18(6-2)15-20(7-3)17-21(8-4)16-19-13-10-9-11-14-19/h5-6,10,12-14H,1-2,7-9,11,15-17H2,3-4H3/b18-12+ |
| InChIKey | NOOFOHXVGVQDKR-LDADJPATSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|