C23H42N2 — CID 145107087
N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine;ethane (PubChem CID 145107087) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine;ethane.
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine;ethane |
|---|---|
| PubChem CID | 145107087 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)-N'-[(2E)-2-ethenylpenta-2,4-dienyl]-N,N'-diethylmethanediamine;ethane |
| SMILES | C=C/C=C(\C=C)CN(CC)CN(CC)CC1=CCCC=C1.CC.CC |
| InChI | InChI=1S/C19H30N2.2C2H6/c1-5-12-18(6-2)15-20(7-3)17-21(8-4)16-19-13-10-9-11-14-19;2*1-2/h5-6,10,12-14H,1-2,7-9,11,15-17H2,3-4H3;2*1-2H3/b18-12+;; |
| InChIKey | IJVWLAUFIFVOHK-JKXROLASSA-N |
| XLogP | 6.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|