C12H16N3+ — CID 123779829
7-piperidin-4-yl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine (PubChem CID 123779829) has the molecular formula C12H16N3+ and a molecular weight of 202.28 g/mol. Its IUPAC name is 7-piperidin-4-yl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine.
| Compound Name | 7-piperidin-4-yl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 123779829 |
| Molecular Formula | C12H16N3+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 7-piperidin-4-yl-7-azoniabicyclo[4.2.0]octa-1(8),2,4,6-tetraen-3-amine |
| SMILES | Nc1ccc2c(c1)=C[N+]=2C1CCNCC1 |
| InChI | InChI=1S/C12H16N3/c13-10-1-2-12-9(7-10)8-15(12)11-3-5-14-6-4-11/h1-2,7-8,11,14H,3-6,13H2/q+1 |
| InChIKey | RRHNQDPSHGQVLA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|