About 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine
2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine (PubChem CID 91024706) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine.
Analyze 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine?
The IUPAC name of 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine (CID 91024706) is 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine.
What is the SMILES notation for 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine?
The canonical SMILES for 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine is C=c1cc2c(nc1=C)CCNC2.
What is the InChIKey of 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine?
The InChIKey is MNCQFDMQMSTPHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-5-9-6-11-4-3-10(9)12-8(7)2/h5,11H,1-4,6H2.
What are the key properties of 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine?
2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine has a molecular weight of 160.22 g/mol, XLogP of -0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylidene-5,6,7,8-tetrahydro-1,6-naphthyridine is sourced from PubChem (CID 91024706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).