C20H21N7 — CID 123782635
N-cyclopentyl-6-[5-methanimidoyl-4-(pyridin-2-ylamino)-2-pyridinyl]pyrazin-2-amine (PubChem CID 123782635) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is N-cyclopentyl-6-[5-methanimidoyl-4-(pyridin-2-ylamino)-2-pyridinyl]pyrazin-2-amine.
| Compound Name | N-cyclopentyl-6-[5-methanimidoyl-4-(pyridin-2-ylamino)-2-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 123782635 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-cyclopentyl-6-[5-methanimidoyl-4-(pyridin-2-ylamino)-2-pyridinyl]pyrazin-2-amine |
| SMILES | [H]/N=C/c1cnc(-c2cncc(NC3CCCC3)n2)cc1Nc1ccccn1 |
| InChI | InChI=1S/C20H21N7/c21-10-14-11-24-17(9-16(14)26-19-7-3-4-8-23-19)18-12-22-13-20(27-18)25-15-5-1-2-6-15/h3-4,7-13,15,21H,1-2,5-6H2,(H,25,27)(H,23,24,26)/b21-10+ |
| InChIKey | UXNKQAYCSBNACT-UFFVCSGVSA-N |
| XLogP | 4.03 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|