C25H40N2O2 — CID 123783176
6-[4-(aminomethyl)phenyl]-N,N-dipropylhexan-1-amine;5-methylfuran-2-carbaldehyde (PubChem CID 123783176) has the molecular formula C25H40N2O2 and a molecular weight of 400.61 g/mol. Its IUPAC name is 6-[4-(aminomethyl)phenyl]-N,N-dipropylhexan-1-amine;5-methylfuran-2-carbaldehyde.
| Compound Name | 6-[4-(aminomethyl)phenyl]-N,N-dipropylhexan-1-amine;5-methylfuran-2-carbaldehyde |
|---|---|
| PubChem CID | 123783176 |
| Molecular Formula | C25H40N2O2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | 6-[4-(aminomethyl)phenyl]-N,N-dipropylhexan-1-amine;5-methylfuran-2-carbaldehyde |
| SMILES | CCCN(CCC)CCCCCCc1ccc(CN)cc1.Cc1ccc(C=O)o1 |
| InChI | InChI=1S/C19H34N2.C6H6O2/c1-3-14-21(15-4-2)16-8-6-5-7-9-18-10-12-19(17-20)13-11-18;1-5-2-3-6(4-7)8-5/h10-13H,3-9,14-17,20H2,1-2H3;2-4H,1H3 |
| InChIKey | ZKVIXIUBMZDYQJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|