C22H22O4Si — CID 123785701
ethenyl(2,2,2-triphenoxyethoxy)silane (PubChem CID 123785701) has the molecular formula C22H22O4Si and a molecular weight of 378.50 g/mol. Its IUPAC name is ethenyl(2,2,2-triphenoxyethoxy)silane.
| Compound Name | ethenyl(2,2,2-triphenoxyethoxy)silane |
|---|---|
| PubChem CID | 123785701 |
| Molecular Formula | C22H22O4Si |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | ethenyl(2,2,2-triphenoxyethoxy)silane |
| SMILES | C=C[SiH2]OCC(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C22H22O4Si/c1-2-27-23-18-22(24-19-12-6-3-7-13-19,25-20-14-8-4-9-15-20)26-21-16-10-5-11-17-21/h2-17H,1,18,27H2 |
| InChIKey | FJBSNCLFJPSKJM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|