C11H22S2 — CID 123786369
3-ethylsulfanyl-2,5-dimethylhept-2-ene-1-thiol (PubChem CID 123786369) has the molecular formula C11H22S2 and a molecular weight of 218.43 g/mol. Its IUPAC name is 3-ethylsulfanyl-2,5-dimethylhept-2-ene-1-thiol.
| Compound Name | 3-ethylsulfanyl-2,5-dimethylhept-2-ene-1-thiol |
|---|---|
| PubChem CID | 123786369 |
| Molecular Formula | C11H22S2 |
| Molecular Weight | 218.43 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-ethylsulfanyl-2,5-dimethylhept-2-ene-1-thiol |
| SMILES | CCSC(CC(C)CC)=C(C)CS |
| InChI | InChI=1S/C11H22S2/c1-5-9(3)7-11(13-6-2)10(4)8-12/h9,12H,5-8H2,1-4H3 |
| InChIKey | HZRLWJKHHWYJGO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|