C15H11ClFNO5 — CID 123786714
3-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-4-nitrobenzoic acid (PubChem CID 123786714) has the molecular formula C15H11ClFNO5 and a molecular weight of 339.71 g/mol. Its IUPAC name is 3-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-4-nitrobenzoic acid.
| Compound Name | 3-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 123786714 |
| Molecular Formula | C15H11ClFNO5 |
| Molecular Weight | 339.71 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(CC(O)c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C15H11ClFNO5/c16-10-2-1-3-11(17)14(10)13(19)7-9-6-8(15(20)21)4-5-12(9)18(22)23/h1-6,13,19H,7H2,(H,20,21) |
| InChIKey | BBANHLXXKFGYGC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|