C14H19N2+ — CID 123787689
methyl-[4-(4-methylanilino)cyclohexa-2,5-dien-1-yl]azanium (PubChem CID 123787689) has the molecular formula C14H19N2+ and a molecular weight of 215.32 g/mol. Its IUPAC name is methyl-[4-(4-methylanilino)cyclohexa-2,5-dien-1-yl]azanium.
| Compound Name | methyl-[4-(4-methylanilino)cyclohexa-2,5-dien-1-yl]azanium |
|---|---|
| PubChem CID | 123787689 |
| Molecular Formula | C14H19N2+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | methyl-[4-(4-methylanilino)cyclohexa-2,5-dien-1-yl]azanium |
| SMILES | C[NH2+]C1C=CC(Nc2ccc(C)cc2)C=C1 |
| InChI | InChI=1S/C14H18N2/c1-11-3-5-13(6-4-11)16-14-9-7-12(15-2)8-10-14/h3-10,12,14-16H,1-2H3/p+1 |
| InChIKey | GRNXLIBAFYPKLA-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 28.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|