C26H27N4+ — CID 91360068
[4-[4-(methylamino)anilino]phenyl]-[4-(4-methylanilino)cyclohexa-2,5-dien-1-ylidene]azanium (PubChem CID 91360068) has the molecular formula C26H27N4+ and a molecular weight of 395.53 g/mol. Its IUPAC name is [4-[4-(methylamino)anilino]phenyl]-[4-(4-methylanilino)cyclohexa-2,5-dien-1-ylidene]azanium.
| Compound Name | [4-[4-(methylamino)anilino]phenyl]-[4-(4-methylanilino)cyclohexa-2,5-dien-1-ylidene]azanium |
|---|---|
| PubChem CID | 91360068 |
| Molecular Formula | C26H27N4+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [4-[4-(methylamino)anilino]phenyl]-[4-(4-methylanilino)cyclohexa-2,5-dien-1-ylidene]azanium |
| SMILES | CNc1ccc(Nc2ccc([NH+]=C3C=CC(Nc4ccc(C)cc4)C=C3)cc2)cc1 |
| InChI | InChI=1S/C26H26N4/c1-19-3-5-21(6-4-19)28-23-11-13-25(14-12-23)30-26-17-15-24(16-18-26)29-22-9-7-20(27-2)8-10-22/h3-18,23,27-29H,1-2H3/p+1/b30-25- |
| InChIKey | QHGSXZLTOGJQAV-JVCXMKTPSA-O |
| XLogP | 4.54 |
| TPSA | 50.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|