C25H28N2O2 — CID 123788920
1'-ethyl-N-(2-methyl-3-pyridinyl)spiro[oxirane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-carboxamide (PubChem CID 123788920) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1'-ethyl-N-(2-methyl-3-pyridinyl)spiro[oxirane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-carboxamide.
| Compound Name | 1'-ethyl-N-(2-methyl-3-pyridinyl)spiro[oxirane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-carboxamide |
|---|---|
| PubChem CID | 123788920 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1'-ethyl-N-(2-methyl-3-pyridinyl)spiro[oxirane-2,13'-tricyclo[9.4.0.02,7]pentadeca-2(7),3,5,8-tetraene]-5'-carboxamide |
| SMILES | CCC12CCC3(CO3)CC1CC=Cc1cc(C(=O)Nc3cccnc3C)ccc12 |
| InChI | InChI=1S/C25H28N2O2/c1-3-25-12-11-24(16-29-24)15-20(25)7-4-6-18-14-19(9-10-21(18)25)23(28)27-22-8-5-13-26-17(22)2/h4-6,8-10,13-14,20H,3,7,11-12,15-16H2,1-2H3,(H,27,28) |
| InChIKey | XSQUHPRFVRUWJN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|