C17H24ClFN2O3 — CID 123795880
[[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methylamino]-(oxolan-3-yl)methanol (PubChem CID 123795880) has the molecular formula C17H24ClFN2O3 and a molecular weight of 358.84 g/mol. Its IUPAC name is [[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methylamino]-(oxolan-3-yl)methanol.
| Compound Name | [[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methylamino]-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 123795880 |
| Molecular Formula | C17H24ClFN2O3 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]methylamino]-(oxolan-3-yl)methanol |
| SMILES | OC(NCC1CNCCOC1c1ccc(Cl)c(F)c1)C1CCOC1 |
| InChI | InChI=1S/C17H24ClFN2O3/c18-14-2-1-11(7-15(14)19)16-13(8-20-4-6-24-16)9-21-17(22)12-3-5-23-10-12/h1-2,7,12-13,16-17,20-22H,3-6,8-10H2 |
| InChIKey | SVISOBKNZBLKCI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|