C12H15ClFN2O3S- — CID 66975284
7-(3-chloro-4-fluorophenyl)-6-[(sulfinatoamino)methyl]-1,4-oxazepane (PubChem CID 66975284) has the molecular formula C12H15ClFN2O3S- and a molecular weight of 321.78 g/mol. Its IUPAC name is 7-(3-chloro-4-fluorophenyl)-6-[(sulfinatoamino)methyl]-1,4-oxazepane.
| Compound Name | 7-(3-chloro-4-fluorophenyl)-6-[(sulfinatoamino)methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 66975284 |
| Molecular Formula | C12H15ClFN2O3S- |
| Molecular Weight | 321.78 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 7-(3-chloro-4-fluorophenyl)-6-[(sulfinatoamino)methyl]-1,4-oxazepane |
| SMILES | O=S([O-])NCC1CNCCOC1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClFN2O3S/c13-10-5-8(1-2-11(10)14)12-9(7-16-20(17)18)6-15-3-4-19-12/h1-2,5,9,12,15-16H,3-4,6-7H2,(H,17,18)/p-1 |
| InChIKey | NTJOUDHHDMCPMF-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.78 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|