C17H21ClFN3O6 — CID 158993144
(E)-but-2-enedioic acid;[(6S,7R)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea (PubChem CID 158993144) has the molecular formula C17H21ClFN3O6 and a molecular weight of 417.82 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(6S,7R)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea.
| Compound Name | (E)-but-2-enedioic acid;[(6S,7R)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea |
|---|---|
| PubChem CID | 158993144 |
| Molecular Formula | C17H21ClFN3O6 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (E)-but-2-enedioic acid;[(6S,7R)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea |
| SMILES | NC(=O)NC[C@@H]1CNCCO[C@H]1c1ccc(F)c(Cl)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H17ClFN3O2.C4H4O4/c14-10-5-8(1-2-11(10)15)12-9(7-18-13(16)19)6-17-3-4-20-12;5-3(6)1-2-4(7)8/h1-2,5,9,12,17H,3-4,6-7H2,(H3,16,18,19);1-2H,(H,5,6)(H,7,8)/b;2-1+/t9-,12-;/m0./s1 |
| InChIKey | JQKKOIFMOPGQQN-YBGUYBTCSA-N |
| XLogP | 1.14 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|