C22H28FNO4 — CID 123796381
tert-butyl 3-[4-[2-[(3-fluoro-2-methylbut-2-enoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate (PubChem CID 123796381) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is tert-butyl 3-[4-[2-[(3-fluoro-2-methylbut-2-enoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl 3-[4-[2-[(3-fluoro-2-methylbut-2-enoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123796381 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl 3-[4-[2-[(3-fluoro-2-methylbut-2-enoyl)amino]-2-methylpropanoyl]phenyl]prop-2-enoate |
| SMILES | CC(F)=C(C)C(=O)NC(C)(C)C(=O)c1ccc(C=CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28FNO4/c1-14(15(2)23)20(27)24-22(6,7)19(26)17-11-8-16(9-12-17)10-13-18(25)28-21(3,4)5/h8-13H,1-7H3,(H,24,27) |
| InChIKey | FVERMISHVANMLU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|