C9H15NO4S — CID 123799566
(2R)-2-acetamido-3-formyl-2-(sulfanylmethyl)pentanoic acid (PubChem CID 123799566) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is (2R)-2-acetamido-3-formyl-2-(sulfanylmethyl)pentanoic acid.
| Compound Name | (2R)-2-acetamido-3-formyl-2-(sulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 123799566 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (2R)-2-acetamido-3-formyl-2-(sulfanylmethyl)pentanoic acid |
| SMILES | CCC(C=O)[C@@](CS)(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C9H15NO4S/c1-3-7(4-11)9(5-15,8(13)14)10-6(2)12/h4,7,15H,3,5H2,1-2H3,(H,10,12)(H,13,14)/t7?,9-/m1/s1 |
| InChIKey | UEBVJKXVGCVHMS-NHSZFOGYSA-N |
| XLogP | 0.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|